C30H34F2N2O5 — CID 163851147
CID 163851147 (PubChem CID 163851147) has the molecular formula C30H34F2N2O5 and a molecular weight of 540.61 g/mol.
| Compound Name | CID 163851147 |
|---|---|
| PubChem CID | 163851147 |
| Molecular Formula | C30H34F2N2O5 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | — |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4F)c3C=C1CC[C@@H]1[C@@H]2[C@@H](O)C[C@@]2(C)[C@H]1CC[C@@]21OCO[C@@]12COCO2 |
| InChI | InChI=1S/C30H34F2N2O5/c1-27-11-17-13-33-34(23-6-4-19(31)10-22(23)32)24(17)9-18(27)3-5-20-21-7-8-29(28(21,2)12-25(35)26(20)27)30(39-16-37-29)14-36-15-38-30/h4,6,9-10,13,20-21,25-26,35H,3,5,7-8,11-12,14-16H2,1-2H3/t20-,21-,25-,26+,27-,28-,29+,30-/m0/s1 |
| InChIKey | OULNJBVKOOHRJZ-FMKPKCTCSA-N |
| XLogP | 4.75 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |