C28H31FN4O2S — CID 90914495
S-(cyanomethyl) 7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate (PubChem CID 90914495) has the molecular formula C28H31FN4O2S and a molecular weight of 506.65 g/mol. Its IUPAC name is S-(cyanomethyl) 7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate.
| Compound Name | S-(cyanomethyl) 7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
|---|---|
| PubChem CID | 90914495 |
| Molecular Formula | C28H31FN4O2S |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | S-(cyanomethyl) 7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
| SMILES | CC12Cc3cnn(-c4ccc(F)nc4)c3C=C1CCC1C2C(O)CC2(C)C(C(=O)SCC#N)CCC12 |
| InChI | InChI=1S/C28H31FN4O2S/c1-27-12-16-14-32-33(18-4-8-24(29)31-15-18)22(16)11-17(27)3-5-19-20-6-7-21(26(35)36-10-9-30)28(20,2)13-23(34)25(19)27/h4,8,11,14-15,19-21,23,25,34H,3,5-7,10,12-13H2,1-2H3 |
| InChIKey | TUMCKYNYKIZJLG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|