C27H30F3N3O2S — CID 91314701
S-(fluoromethyl) 1-fluoro-7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate (PubChem CID 91314701) has the molecular formula C27H30F3N3O2S and a molecular weight of 517.62 g/mol. Its IUPAC name is S-(fluoromethyl) 1-fluoro-7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate.
| Compound Name | S-(fluoromethyl) 1-fluoro-7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
|---|---|
| PubChem CID | 91314701 |
| Molecular Formula | C27H30F3N3O2S |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | S-(fluoromethyl) 1-fluoro-7-(6-fluoro-3-pyridinyl)-20-hydroxy-2,18-dimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioate |
| SMILES | CC12CC(O)C3(F)C(CCC4=Cc5c(cnn5-c5ccc(F)nc5)CC43C)C1CCC2C(=O)SCF |
| InChI | InChI=1S/C27H30F3N3O2S/c1-25-11-22(34)27(30)19(18(25)6-7-20(25)24(35)36-14-28)5-3-16-9-21-15(10-26(16,27)2)12-32-33(21)17-4-8-23(29)31-13-17/h4,8-9,12-13,18-20,22,34H,3,5-7,10-11,14H2,1-2H3 |
| InChIKey | MVIZWCMDWCSIDB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|