C28H34ClN3O4 — CID 11049504
1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(6-chloro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone (PubChem CID 11049504) has the molecular formula C28H34ClN3O4 and a molecular weight of 512.05 g/mol. Its IUPAC name is 1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(6-chloro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(6-chloro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 11049504 |
| Molecular Formula | C28H34ClN3O4 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(6-chloro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=Cc5c(cnn5-c5ccc(Cl)nc5)C[C@]4(C)[C@H]3[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C28H34ClN3O4/c1-15-8-20-19-6-4-17-9-21-16(12-31-32(21)18-5-7-24(29)30-13-18)10-26(17,2)25(19)22(34)11-27(20,3)28(15,36)23(35)14-33/h5,7,9,12-13,15,19-20,22,25,33-34,36H,4,6,8,10-11,14H2,1-3H3/t15-,19+,20+,22+,25-,26+,27+,28+/m1/s1 |
| InChIKey | CUKGWZLHMNLKBC-PPBJAPPYSA-N |
| XLogP | 3.61 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|