C28H34FN3O4 — CID 10907172
1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(2-fluoro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone (PubChem CID 10907172) has the molecular formula C28H34FN3O4 and a molecular weight of 495.60 g/mol. Its IUPAC name is 1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(2-fluoro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone.
| Compound Name | 1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(2-fluoro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 10907172 |
| Molecular Formula | C28H34FN3O4 |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 1-[(1S,2R,13S,14S,16R,17R,18S,20S)-7-(2-fluoro-3-pyridinyl)-17,20-dihydroxy-2,16,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-trien-17-yl]-2-hydroxyethanone |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=Cc5c(cnn5-c5cccnc5F)C[C@]4(C)[C@H]3[C@@H](O)C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C28H34FN3O4/c1-15-9-19-18-7-6-17-10-21-16(13-31-32(21)20-5-4-8-30-25(20)29)11-26(17,2)24(18)22(34)12-27(19,3)28(15,36)23(35)14-33/h4-5,8,10,13,15,18-19,22,24,33-34,36H,6-7,9,11-12,14H2,1-3H3/t15-,18+,19+,22+,24-,26+,27+,28+/m1/s1 |
| InChIKey | FVNYHVCYUWRLOS-SZJDNHDKSA-N |
| XLogP | 3.10 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|