C22H28F2O5 — CID 18601895
(8S,9S,10R,13S,14S,17R)-1,2-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one (PubChem CID 18601895) has the molecular formula C22H28F2O5 and a molecular weight of 410.46 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17R)-1,2-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17R)-1,2-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 18601895 |
| Molecular Formula | C22H28F2O5 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (8S,9S,10R,13S,14S,17R)-1,2-difluoro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@H]2[C@@H]3CCC4=CC(=O)C(F)=C(F)[C@]4(C)[C@H]3C(O)C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H28F2O5/c1-10-6-13-12-5-4-11-7-14(26)18(23)19(24)21(11,3)17(12)15(27)8-20(13,2)22(10,29)16(28)9-25/h7,10,12-13,15,17,25,27,29H,4-6,8-9H2,1-3H3/t10?,12-,13-,15?,17+,20-,21-,22-/m0/s1 |
| InChIKey | MVUWMGUIAVIUEH-JVTOVUPZSA-N |
| XLogP | 2.40 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|