C26H34F2O6 — CID 70519941
[(8S,9S,10R,13S,14S,16S,17R)-1,2-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 70519941) has the molecular formula C26H34F2O6 and a molecular weight of 480.55 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,16S,17R)-1,2-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(8S,9S,10R,13S,14S,16S,17R)-1,2-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 70519941 |
| Molecular Formula | C26H34F2O6 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [(8S,9S,10R,13S,14S,16S,17R)-1,2-difluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C(=O)CO)[C@@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C(F)=C(F)[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C26H34F2O6/c1-5-6-20(33)34-26(19(32)12-29)13(2)9-16-15-8-7-14-10-17(30)22(27)23(28)25(14,4)21(15)18(31)11-24(16,26)3/h10,13,15-16,18,21,29,31H,5-9,11-12H2,1-4H3/t13-,15-,16-,18?,21+,24-,25-,26-/m0/s1 |
| InChIKey | GYZNDOVETZEVDY-WGEBSFGLSA-N |
| XLogP | 3.75 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|