C26H35ClO6 — CID 22805977
[(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 22805977) has the molecular formula C26H35ClO6 and a molecular weight of 479.01 g/mol. Its IUPAC name is [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 22805977 |
| Molecular Formula | C26H35ClO6 |
| Molecular Weight | 479.01 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)O[C@@]1(C(=O)CO)[C@H](C)C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@@]21C)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl |
| InChI | InChI=1S/C26H35ClO6/c1-5-6-21(32)33-26(20(31)13-28)14(2)9-17-22-18(27)11-15-10-16(29)7-8-24(15,3)23(22)19(30)12-25(17,26)4/h7-8,10,14,17-19,22-23,28,30H,5-6,9,11-13H2,1-4H3/t14-,17+,18-,19+,22-,23+,24+,25+,26-/m1/s1 |
| InChIKey | WINACCRBLBEYCJ-QQTYTWSDSA-N |
| XLogP | 3.37 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.01 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|