C27H39ClO6 — CID 22802002
[(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] pentanoate (PubChem CID 22802002) has the molecular formula C27H39ClO6 and a molecular weight of 495.06 g/mol. Its IUPAC name is [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] pentanoate.
| Compound Name | [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] pentanoate |
|---|---|
| PubChem CID | 22802002 |
| Molecular Formula | C27H39ClO6 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | [(7R,8S,9S,10R,11S,13S,14S,16R,17S)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@@]1(C(=O)CO)[C@H](C)C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@@]21C)[C@@]1(C)CCC(=O)C=C1C[C@H]3Cl |
| InChI | InChI=1S/C27H39ClO6/c1-5-6-7-22(33)34-27(21(32)14-29)15(2)10-18-23-19(28)12-16-11-17(30)8-9-25(16,3)24(23)20(31)13-26(18,27)4/h11,15,18-20,23-24,29,31H,5-10,12-14H2,1-4H3/t15-,18+,19-,20+,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | ZAWJSBTVDUSBRA-ALZIBBMWSA-N |
| XLogP | 3.99 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|