C29H35ClO6 — CID 70625934
[(8S,9S,10R,13S,14S,17R)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 70625934) has the molecular formula C29H35ClO6 and a molecular weight of 515.05 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 70625934 |
| Molecular Formula | C29H35ClO6 |
| Molecular Weight | 515.05 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-7-chloro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC1C[C@H]2[C@@H]3C(Cl)CC4=CC(=O)CC[C@]4(C)[C@H]3C(O)C[C@]2(C)[C@@]1(OC(=O)c1ccccc1)C(=O)CO |
| InChI | InChI=1S/C29H35ClO6/c1-16-11-20-24-21(30)13-18-12-19(32)9-10-27(18,2)25(24)22(33)14-28(20,3)29(16,23(34)15-31)36-26(35)17-7-5-4-6-8-17/h4-8,12,16,20-22,24-25,31,33H,9-11,13-15H2,1-3H3/t16?,20-,21?,22?,24+,25-,27-,28-,29-/m0/s1 |
| InChIKey | ADHWNLSKZATFTM-YXKGHVIUSA-N |
| XLogP | 4.11 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.05 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|