C29H32ClFO6 — CID 70470014
[(8S,9R,10S,11S,13S,14S,17S)-9-chloro-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 70470014) has the molecular formula C29H32ClFO6 and a molecular weight of 531.02 g/mol. Its IUPAC name is [(8S,9R,10S,11S,13S,14S,17S)-9-chloro-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(8S,9R,10S,11S,13S,14S,17S)-9-chloro-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 70470014 |
| Molecular Formula | C29H32ClFO6 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | [(8S,9R,10S,11S,13S,14S,17S)-9-chloro-6-fluoro-11-hydroxy-17-(2-hydroxyacetyl)-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@]2(C)[C@]1(OC(=O)c1ccccc1)C(=O)CO |
| InChI | InChI=1S/C29H32ClFO6/c1-16-11-19-20-13-22(31)21-12-18(33)9-10-26(21,2)28(20,30)23(34)14-27(19,3)29(16,24(35)15-32)37-25(36)17-7-5-4-6-8-17/h4-10,12,16,19-20,22-23,32,34H,11,13-15H2,1-3H3/t16?,19-,20-,22?,23-,26-,27-,28-,29+/m0/s1 |
| InChIKey | DUCOTWGJOVLEGO-SXWOPCDUSA-N |
| XLogP | 3.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|