C23H28ClFO7 — CID 70423821
[(6S,8S,9R,10S,11S,13S,14S,16S,17S)-17-carboxyoxy-9-chloro-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 70423821) has the molecular formula C23H28ClFO7 and a molecular weight of 470.92 g/mol. Its IUPAC name is [(6S,8S,9R,10S,11S,13S,14S,16S,17S)-17-carboxyoxy-9-chloro-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(6S,8S,9R,10S,11S,13S,14S,16S,17S)-17-carboxyoxy-9-chloro-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 70423821 |
| Molecular Formula | C23H28ClFO7 |
| Molecular Weight | 470.92 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [(6S,8S,9R,10S,11S,13S,14S,16S,17S)-17-carboxyoxy-9-chloro-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@]1(OC(=O)O)[C@@H](C)C[C@H]2[C@@H]3C[C@H](F)C4=CC(=O)C=C[C@]4(C)[C@@]3(Cl)[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C23H28ClFO7/c1-11-7-14-15-9-17(25)16-8-13(27)5-6-20(16,3)22(15,24)18(28)10-21(14,4)23(11,31-12(2)26)32-19(29)30/h5-6,8,11,14-15,17-18,28H,7,9-10H2,1-4H3,(H,29,30)/t11-,14-,15-,17-,18-,20-,21-,22-,23-/m0/s1 |
| InChIKey | NNWKZCMMBLVRJX-WBUZCWLESA-N |
| XLogP | 3.77 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|