C31H36ClFO6 — CID 10144270
methyl (6S,9R,10S,11S,13S,16S,17R)-9-chloro-17-(4-ethylbenzoyl)oxy-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 10144270) has the molecular formula C31H36ClFO6 and a molecular weight of 559.07 g/mol. Its IUPAC name is methyl (6S,9R,10S,11S,13S,16S,17R)-9-chloro-17-(4-ethylbenzoyl)oxy-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (6S,9R,10S,11S,13S,16S,17R)-9-chloro-17-(4-ethylbenzoyl)oxy-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 10144270 |
| Molecular Formula | C31H36ClFO6 |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | methyl (6S,9R,10S,11S,13S,16S,17R)-9-chloro-17-(4-ethylbenzoyl)oxy-6-fluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | CCc1ccc(C(=O)O[C@]2(C(=O)OC)[C@@H](C)CC3C4C[C@H](F)C5=CC(=O)C=C[C@]5(C)[C@@]4(Cl)[C@@H](O)C[C@@]32C)cc1 |
| InChI | InChI=1S/C31H36ClFO6/c1-6-18-7-9-19(10-8-18)26(36)39-31(27(37)38-5)17(2)13-21-22-15-24(33)23-14-20(34)11-12-28(23,3)30(22,32)25(35)16-29(21,31)4/h7-12,14,17,21-22,24-25,35H,6,13,15-16H2,1-5H3/t17-,21?,22?,24-,25-,28-,29-,30-,31-/m0/s1 |
| InChIKey | UELFZCVHOMZDRE-DZYBNEOVSA-N |
| XLogP | 5.15 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|