C28H39ClO7 — CID 70626700
[(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methylpropanoate (PubChem CID 70626700) has the molecular formula C28H39ClO7 and a molecular weight of 523.07 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methylpropanoate.
| Compound Name | [(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 70626700 |
| Molecular Formula | C28H39ClO7 |
| Molecular Weight | 523.07 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17R)-17-(2-acetyloxyacetyl)-7-chloro-11-hydroxy-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl] 2-methylpropanoate |
| SMILES | CC(=O)OCC(=O)[C@@]1(OC(=O)C(C)C)C(C)C[C@H]2[C@@H]3C(Cl)CC4=CC(=O)CC[C@]4(C)[C@H]3C(O)C[C@@]21C |
| InChI | InChI=1S/C28H39ClO7/c1-14(2)25(34)36-28(22(33)13-35-16(4)30)15(3)9-19-23-20(29)11-17-10-18(31)7-8-26(17,5)24(23)21(32)12-27(19,28)6/h10,14-15,19-21,23-24,32H,7-9,11-13H2,1-6H3/t15?,19-,20?,21?,23+,24-,26-,27-,28-/m0/s1 |
| InChIKey | IBTLBGDUWMSXFS-WRTOBVRESA-N |
| XLogP | 4.02 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.07 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|