C23H30F2O4 — CID 67134090
[(8S,9S,10R,11S,13S,14S,16R,17S)-1,2-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 67134090) has the molecular formula C23H30F2O4 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(8S,9S,10R,11S,13S,14S,16R,17S)-1,2-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8S,9S,10R,11S,13S,14S,16R,17S)-1,2-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 67134090 |
| Molecular Formula | C23H30F2O4 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(8S,9S,10R,11S,13S,14S,16R,17S)-1,2-difluoro-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C(F)=C(F)[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C23H30F2O4/c1-5-17(28)29-21-11(2)8-14-13-7-6-12-9-15(26)19(24)20(25)23(12,4)18(13)16(27)10-22(14,21)3/h9,11,13-14,16,18,21,27H,5-8,10H2,1-4H3/t11-,13+,14+,16+,18-,21+,22+,23+/m1/s1 |
| InChIKey | GCAVMPZVTIBDPG-IRXAPNQZSA-N |
| XLogP | 4.43 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|