C27H40N2O6 — CID 177370224
(11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 3-[[[(2S)-2-aminopropanoyl]amino]methoxy]propanoate (PubChem CID 177370224) has the molecular formula C27H40N2O6 and a molecular weight of 488.63 g/mol. Its IUPAC name is (11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 3-[[[(2S)-2-aminopropanoyl]amino]methoxy]propanoate.
| Compound Name | (11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 3-[[[(2S)-2-aminopropanoyl]amino]methoxy]propanoate |
|---|---|
| PubChem CID | 177370224 |
| Molecular Formula | C27H40N2O6 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | (11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl) 3-[[[(2S)-2-aminopropanoyl]amino]methoxy]propanoate |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1OC(=O)CCOCNC(=O)[C@H](C)N |
| InChI | InChI=1S/C27H40N2O6/c1-15-11-20-19-6-5-17-12-18(30)7-9-26(17,3)23(19)21(31)13-27(20,4)24(15)35-22(32)8-10-34-14-29-25(33)16(2)28/h7,9,12,15-16,19-21,23-24,31H,5-6,8,10-11,13-14,28H2,1-4H3,(H,29,33)/t15?,16-,19?,20?,21?,23?,24?,26?,27?/m0/s1 |
| InChIKey | CEMWRLVKBVBIRY-OMQWXBQNSA-N |
| XLogP | 2.25 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|