C22H28ClFO3 — CID 154341600
(8S,9S,10R,11R,13S,14S,16S,17S)-17-(2-chloro-2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154341600) has the molecular formula C22H28ClFO3 and a molecular weight of 394.91 g/mol. Its IUPAC name is (8S,9S,10R,11R,13S,14S,16S,17S)-17-(2-chloro-2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,11R,13S,14S,16S,17S)-17-(2-chloro-2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154341600 |
| Molecular Formula | C22H28ClFO3 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | (8S,9S,10R,11R,13S,14S,16S,17S)-17-(2-chloro-2-fluoroacetyl)-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3[C@H](O)C[C@]2(C)[C@H]1C(=O)C(F)Cl |
| InChI | InChI=1S/C22H28ClFO3/c1-11-8-15-14-5-4-12-9-13(25)6-7-21(12,2)18(14)16(26)10-22(15,3)17(11)19(27)20(23)24/h6-7,9,11,14-18,20,26H,4-5,8,10H2,1-3H3/t11-,14-,15-,16+,17+,18+,20?,21-,22-/m0/s1 |
| InChIKey | GQVXGWMBEOLYMN-INOSYPISSA-N |
| XLogP | 4.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|