C28H44O5 — CID 142985183
ethane;[(17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate;propan-2-one (PubChem CID 142985183) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is ethane;[(17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate;propan-2-one.
| Compound Name | ethane;[(17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate;propan-2-one |
|---|---|
| PubChem CID | 142985183 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | ethane;[(17R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate;propan-2-one |
| SMILES | CC.CC(C)=O.CCC(=O)O[C@@H]1C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C23H32O4.C3H6O.C2H6/c1-5-19(26)27-21-13(2)10-17-16-7-6-14-11-15(24)8-9-22(14,3)20(16)18(25)12-23(17,21)4;1-3(2)4;1-2/h8-9,11,13,16-18,20-21,25H,5-7,10,12H2,1-4H3;1-2H3;1-2H3/t13?,16?,17?,18?,20?,21-,22?,23?;;/m1../s1 |
| InChIKey | NYWAUZHOCHRECU-ZKVKSSMCSA-N |
| XLogP | 5.45 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |