C25H33NO8 — CID 143419402
[2-(11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-nitrooxypropanoate (PubChem CID 143419402) has the molecular formula C25H33NO8 and a molecular weight of 475.54 g/mol. Its IUPAC name is [2-(11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-nitrooxypropanoate.
| Compound Name | [2-(11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-nitrooxypropanoate |
|---|---|
| PubChem CID | 143419402 |
| Molecular Formula | C25H33NO8 |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | [2-(11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] 3-nitrooxypropanoate |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1C(=O)COC(=O)CCO[N+](=O)[O-] |
| InChI | InChI=1S/C25H33NO8/c1-14-10-18-17-5-4-15-11-16(27)6-8-24(15,2)23(17)19(28)12-25(18,3)22(14)20(29)13-33-21(30)7-9-34-26(31)32/h6,8,11,14,17-19,22-23,28H,4-5,7,9-10,12-13H2,1-3H3 |
| InChIKey | VHBDKYQMEQKKDP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 133.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|