C27H39BrO6 — CID 143936589
17-[2-(4-bromo-1-hydroxy-1-methoxybutoxy)acetyl]-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 143936589) has the molecular formula C27H39BrO6 and a molecular weight of 539.51 g/mol. Its IUPAC name is 17-[2-(4-bromo-1-hydroxy-1-methoxybutoxy)acetyl]-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-[2-(4-bromo-1-hydroxy-1-methoxybutoxy)acetyl]-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 143936589 |
| Molecular Formula | C27H39BrO6 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 17-[2-(4-bromo-1-hydroxy-1-methoxybutoxy)acetyl]-11-hydroxy-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | COC(O)(CCCBr)OCC(=O)C1C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C27H39BrO6/c1-16-12-20-19-7-6-17-13-18(29)8-10-25(17,2)24(19)21(30)14-26(20,3)23(16)22(31)15-34-27(32,33-4)9-5-11-28/h8,10,13,16,19-21,23-24,30,32H,5-7,9,11-12,14-15H2,1-4H3 |
| InChIKey | CVFDENLKPTVKKJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|