C31H44N2O14 — CID 143936683
[2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrooxybutyl carbonate;4-nitrooxybutanoic acid (PubChem CID 143936683) has the molecular formula C31H44N2O14 and a molecular weight of 668.69 g/mol. Its IUPAC name is [2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrooxybutyl carbonate;4-nitrooxybutanoic acid.
| Compound Name | [2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrooxybutyl carbonate;4-nitrooxybutanoic acid |
|---|---|
| PubChem CID | 143936683 |
| Molecular Formula | C31H44N2O14 |
| Molecular Weight | 668.69 g/mol |
| Exact Mass | 668.28 |
| IUPAC Name | [2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-nitrooxybutyl carbonate;4-nitrooxybutanoic acid |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1C(=O)COC(=O)OCCCCO[N+](=O)[O-].O=C(O)CCCO[N+](=O)[O-] |
| InChI | InChI=1S/C27H37NO9.C4H7NO5/c1-16-12-20-19-7-6-17-13-18(29)8-9-26(17,2)24(19)21(30)14-27(20,3)23(16)22(31)15-36-25(32)35-10-4-5-11-37-28(33)34;6-4(7)2-1-3-10-5(8)9/h8-9,13,16,19-21,23-24,30H,4-7,10-12,14-15H2,1-3H3;1-3H2,(H,6,7)/t16-,19?,20?,21?,23?,24?,26?,27?;/m1./s1 |
| InChIKey | WPYKXDQZGAGOKO-VKPVKMPHSA-N |
| XLogP | 3.90 |
| TPSA | 231.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|