C33H39NO13 — CID 143936514
4-nitrooxybutyl 4-[2-(10-hydroxy-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran-1-yl)-2-oxoethoxy]carbonyloxy-3-methoxybenzoate (PubChem CID 143936514) has the molecular formula C33H39NO13 and a molecular weight of 657.67 g/mol. Its IUPAC name is 4-nitrooxybutyl 4-[2-(10-hydroxy-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran-1-yl)-2-oxoethoxy]carbonyloxy-3-methoxybenzoate.
| Compound Name | 4-nitrooxybutyl 4-[2-(10-hydroxy-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran-1-yl)-2-oxoethoxy]carbonyloxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 143936514 |
| Molecular Formula | C33H39NO13 |
| Molecular Weight | 657.67 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | 4-nitrooxybutyl 4-[2-(10-hydroxy-9a,11a-dimethyl-7-oxo-3,3a,3b,4,5,9b,10,11-octahydro-1H-naphtho[2,1-e][2]benzofuran-1-yl)-2-oxoethoxy]carbonyloxy-3-methoxybenzoate |
| SMILES | COc1cc(C(=O)OCCCCO[N+](=O)[O-])ccc1OC(=O)OCC(=O)C1OCC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C33H39NO13/c1-32-11-10-21(35)15-20(32)7-8-22-23-17-44-29(33(23,2)16-24(36)28(22)32)25(37)18-45-31(39)47-26-9-6-19(14-27(26)42-3)30(38)43-12-4-5-13-46-34(40)41/h6,9-11,14-15,22-24,28-29,36H,4-5,7-8,12-13,16-18H2,1-3H3 |
| InChIKey | KXGDPGMFTBXSMX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 187.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.67 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|