C29H33NO9 — CID 143419380
[2-(11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] [3-(nitrooxymethyl)phenyl] carbonate (PubChem CID 143419380) has the molecular formula C29H33NO9 and a molecular weight of 539.58 g/mol. Its IUPAC name is [2-(11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] [3-(nitrooxymethyl)phenyl] carbonate.
| Compound Name | [2-(11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] [3-(nitrooxymethyl)phenyl] carbonate |
|---|---|
| PubChem CID | 143419380 |
| Molecular Formula | C29H33NO9 |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | [2-(11-hydroxy-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-oxoethyl] [3-(nitrooxymethyl)phenyl] carbonate |
| SMILES | CC12C=CC(=O)C=C1CCC1C2C(O)CC2(C)C(C(=O)COC(=O)Oc3cccc(CO[N+](=O)[O-])c3)CCC12 |
| InChI | InChI=1S/C29H33NO9/c1-28-11-10-19(31)13-18(28)6-7-21-22-8-9-23(29(22,2)14-24(32)26(21)28)25(33)16-37-27(34)39-20-5-3-4-17(12-20)15-38-30(35)36/h3-5,10-13,21-24,26,32H,6-9,14-16H2,1-2H3 |
| InChIKey | NNODIAIETIJYHU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|