C34H45NO9 — CID 153355361
1-O-(2,5-dioxopyrrolidin-1-yl) 6-O-[2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,5-dimethylhexanedioate (PubChem CID 153355361) has the molecular formula C34H45NO9 and a molecular weight of 611.73 g/mol. Its IUPAC name is 1-O-(2,5-dioxopyrrolidin-1-yl) 6-O-[2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,5-dimethylhexanedioate.
| Compound Name | 1-O-(2,5-dioxopyrrolidin-1-yl) 6-O-[2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,5-dimethylhexanedioate |
|---|---|
| PubChem CID | 153355361 |
| Molecular Formula | C34H45NO9 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.31 |
| IUPAC Name | 1-O-(2,5-dioxopyrrolidin-1-yl) 6-O-[2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 2,5-dimethylhexanedioate |
| SMILES | CC(CCC(C)C(=O)ON1C(=O)CCC1=O)C(=O)OCC(=O)C1[C@H](C)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C34H45NO9/c1-18(6-7-19(2)32(42)44-35-27(39)10-11-28(35)40)31(41)43-17-26(38)29-20(3)14-24-23-9-8-21-15-22(36)12-13-33(21,4)30(23)25(37)16-34(24,29)5/h12-13,15,18-20,23-25,29-30,37H,6-11,14,16-17H2,1-5H3/t18?,19?,20-,23?,24?,25?,29?,30?,33?,34?/m1/s1 |
| InChIKey | TZAUCZYEDOVNKJ-SOIODGOHSA-N |
| XLogP | 3.90 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|