C23H32NO5+ — CID 153355368
[2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]carbonylazanium (PubChem CID 153355368) has the molecular formula C23H32NO5+ and a molecular weight of 402.51 g/mol. Its IUPAC name is [2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]carbonylazanium.
| Compound Name | [2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]carbonylazanium |
|---|---|
| PubChem CID | 153355368 |
| Molecular Formula | C23H32NO5+ |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | [2-[(16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethoxy]carbonylazanium |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1C(=O)COC([NH3+])=O |
| InChI | InChI=1S/C23H31NO5/c1-12-8-16-15-5-4-13-9-14(25)6-7-22(13,2)20(15)17(26)10-23(16,3)19(12)18(27)11-29-21(24)28/h6-7,9,12,15-17,19-20,26H,4-5,8,10-11H2,1-3H3,(H2,24,28)/p+1/t12-,15?,16?,17?,19?,20?,22?,23?/m1/s1 |
| InChIKey | FBOYDXLTEFIGLX-KNXLEWHKSA-O |
| XLogP | 2.07 |
| TPSA | 108.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |