C23H30O5 — CID 139378511
[2-[(8S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] formate (PubChem CID 139378511) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is [2-[(8S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] formate.
| Compound Name | [2-[(8S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] formate |
|---|---|
| PubChem CID | 139378511 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [2-[(8S,16R)-11-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] formate |
| SMILES | C[C@@H]1CC2[C@@H]3CCC4=CC(=O)C=CC4(C)C3C(O)CC2(C)C1C(=O)COC=O |
| InChI | InChI=1S/C23H30O5/c1-13-8-17-16-5-4-14-9-15(25)6-7-22(14,2)21(16)18(26)10-23(17,3)20(13)19(27)11-28-12-24/h6-7,9,12-13,16-18,20-21,26H,4-5,8,10-11H2,1-3H3/t13-,16+,17?,18?,20?,21?,22?,23?/m1/s1 |
| InChIKey | WIEBZLBFIQWJTM-YDESWRACSA-N |
| XLogP | 2.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|