C31H41N3O3 — CID 67794224
(8S,9S,10R,13S,14S,17S)-11-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67794224) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S,17S)-11-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,9S,10R,13S,14S,17S)-11-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67794224 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | (8S,9S,10R,13S,14S,17S)-11-hydroxy-10,13,16-trimethyl-17-[2-(4-pyridin-2-ylpiperazin-1-yl)acetyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)[C@H]3C(O)C[C@]2(C)[C@H]1C(=O)CN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C31H41N3O3/c1-20-16-24-23-8-7-21-17-22(35)9-10-30(21,2)29(23)25(36)18-31(24,3)28(20)26(37)19-33-12-14-34(15-13-33)27-6-4-5-11-32-27/h4-6,9-11,17,20,23-25,28-29,36H,7-8,12-16,18-19H2,1-3H3/t20?,23-,24-,25?,28+,29+,30-,31-/m0/s1 |
| InChIKey | YCENRCIMLWNOSN-WJLIJCMQSA-N |
| XLogP | 3.91 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |