C24H39NO5 — CID 142968079
(3E,8S,10R,13S,16S,17R)-3-hydroxyimino-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-11,17-diol;methanol;propan-2-one (PubChem CID 142968079) has the molecular formula C24H39NO5 and a molecular weight of 421.58 g/mol. Its IUPAC name is (3E,8S,10R,13S,16S,17R)-3-hydroxyimino-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-11,17-diol;methanol;propan-2-one.
| Compound Name | (3E,8S,10R,13S,16S,17R)-3-hydroxyimino-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-11,17-diol;methanol;propan-2-one |
|---|---|
| PubChem CID | 142968079 |
| Molecular Formula | C24H39NO5 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | (3E,8S,10R,13S,16S,17R)-3-hydroxyimino-10,13,16-trimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-11,17-diol;methanol;propan-2-one |
| SMILES | CC(C)=O.CO.C[C@H]1CC2[C@@H]3CCC4=C/C(=N/O)C=C[C@]4(C)C3C(O)C[C@]2(C)[C@@H]1O |
| InChI | InChI=1S/C20H29NO3.C3H6O.CH4O/c1-11-8-15-14-5-4-12-9-13(21-24)6-7-19(12,2)17(14)16(22)10-20(15,3)18(11)23;1-3(2)4;1-2/h6-7,9,11,14-18,22-24H,4-5,8,10H2,1-3H3;1-2H3;2H,1H3/b21-13+;;/t11-,14-,15?,16?,17?,18+,19-,20-;;/m0../s1 |
| InChIKey | YVVDKHUEPTWYRW-XRTQTOPSSA-N |
| XLogP | 3.34 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|