C20H29NO3 — CID 102236917
(3E,8R,9S,10R,13S,14S,15S,17S)-3-hydroxyimino-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15,17-diol (PubChem CID 102236917) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is (3E,8R,9S,10R,13S,14S,15S,17S)-3-hydroxyimino-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15,17-diol.
| Compound Name | (3E,8R,9S,10R,13S,14S,15S,17S)-3-hydroxyimino-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15,17-diol |
|---|---|
| PubChem CID | 102236917 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | (3E,8R,9S,10R,13S,14S,15S,17S)-3-hydroxyimino-10,13,17-trimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-15,17-diol |
| SMILES | C[C@]12C=C/C(=N\O)C=C1CC[C@H]1[C@@H]3[C@@H](O)C[C@](C)(O)[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C20H29NO3/c1-18-8-6-13(21-24)10-12(18)4-5-14-15(18)7-9-19(2)17(14)16(22)11-20(19,3)23/h6,8,10,14-17,22-24H,4-5,7,9,11H2,1-3H3/b21-13+/t14-,15+,16+,17-,18+,19+,20+/m1/s1 |
| InChIKey | BVURXQKHASTJIL-YMCWZVJBSA-N |
| XLogP | 3.28 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|