C25H37NO3 — CID 123249971
11-hydroxy-10,13-dimethyl-16-[2-(methylamino)ethyl]-17-propanoyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 123249971) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is 11-hydroxy-10,13-dimethyl-16-[2-(methylamino)ethyl]-17-propanoyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 11-hydroxy-10,13-dimethyl-16-[2-(methylamino)ethyl]-17-propanoyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 123249971 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | 11-hydroxy-10,13-dimethyl-16-[2-(methylamino)ethyl]-17-propanoyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCC(=O)C1C(CCNC)CC2C3CCC4=CC(=O)C=CC4(C)C3C(O)CC21C |
| InChI | InChI=1S/C25H37NO3/c1-5-20(28)22-15(9-11-26-4)12-19-18-7-6-16-13-17(27)8-10-24(16,2)23(18)21(29)14-25(19,22)3/h8,10,13,15,18-19,21-23,26,29H,5-7,9,11-12,14H2,1-4H3 |
| InChIKey | NFVZNFVJFZRXAL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |