C23H32O4 — CID 66613375
[(8R,9S,10S,13S,14S,16R,17R)-2-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate (PubChem CID 66613375) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,16R,17R)-2-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate.
| Compound Name | [(8R,9S,10S,13S,14S,16R,17R)-2-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
|---|---|
| PubChem CID | 66613375 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [(8R,9S,10S,13S,14S,16R,17R)-2-hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] propanoate |
| SMILES | CCC(=O)O[C@@H]1[C@H](C)C[C@H]2[C@@H]3CCC4=CC(=O)C(O)=C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H32O4/c1-5-20(26)27-21-13(2)10-17-15-7-6-14-11-18(24)19(25)12-23(14,4)16(15)8-9-22(17,21)3/h11-13,15-17,21,25H,5-10H2,1-4H3/t13-,15-,16+,17+,21-,22+,23+/m1/s1 |
| InChIKey | QHIRKRXNFQWCGA-GJHSCOIVSA-N |
| XLogP | 4.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |