C21H28O3 — CID 77166755
10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid (PubChem CID 77166755) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid.
| Compound Name | 10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
|---|---|
| PubChem CID | 77166755 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carboxylic acid |
| SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C)C3CCC2(C)C1C(=O)O |
| InChI | InChI=1S/C21H28O3/c1-12-10-17-15-5-4-13-11-14(22)6-8-20(13,2)16(15)7-9-21(17,3)18(12)19(23)24/h6,8,11-12,15-18H,4-5,7,9-10H2,1-3H3,(H,23,24) |
| InChIKey | UMZNECIIZITHBS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |