C24H32O5 — CID 70125350
4-[(8S,9S,10R,13S,14S,16S,17S)-16-(hydroxymethyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid (PubChem CID 70125350) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[(8S,9S,10R,13S,14S,16S,17S)-16-(hydroxymethyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(8S,9S,10R,13S,14S,16S,17S)-16-(hydroxymethyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 70125350 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-[(8S,9S,10R,13S,14S,16S,17S)-16-(hydroxymethyl)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-4-oxobutanoic acid |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)C=C[C@@]43C)[C@@H]1C[C@H](CO)[C@@H]2C(=O)CCC(=O)O |
| InChI | InChI=1S/C24H32O5/c1-23-9-7-16(26)12-15(23)3-4-17-18(23)8-10-24(2)19(17)11-14(13-25)22(24)20(27)5-6-21(28)29/h7,9,12,14,17-19,22,25H,3-6,8,10-11,13H2,1-2H3,(H,28,29)/t14-,17-,18+,19+,22-,23+,24+/m1/s1 |
| InChIKey | KKQQCZAMMLZFMG-LYVCXNTCSA-N |
| XLogP | 3.56 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |