C21H28O2 — CID 89166122
(16R)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbaldehyde (PubChem CID 89166122) has the molecular formula C21H28O2 and a molecular weight of 312.45 g/mol. Its IUPAC name is (16R)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbaldehyde.
| Compound Name | (16R)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbaldehyde |
|---|---|
| PubChem CID | 89166122 |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | (16R)-10,13,16-trimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-17-carbaldehyde |
| SMILES | C[C@@H]1CC2C3CCC4=CC(=O)C=CC4(C)C3CCC2(C)C1C=O |
| InChI | InChI=1S/C21H28O2/c1-13-10-18-16-5-4-14-11-15(23)6-8-20(14,2)17(16)7-9-21(18,3)19(13)12-22/h6,8,11-13,16-19H,4-5,7,9-10H2,1-3H3/t13-,16?,17?,18?,19?,20?,21?/m1/s1 |
| InChIKey | IQIVWJVJAGEQCG-RBYYVXPSSA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|