C22H28O5 — CID 18719675
(1S,2R,11S,12S,14R,15R,16S)-15-hydroxy-15-(2-hydroxyacetyl)-2,14,16-trimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-3(5),7-dien-6-one (PubChem CID 18719675) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is (1S,2R,11S,12S,14R,15R,16S)-15-hydroxy-15-(2-hydroxyacetyl)-2,14,16-trimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-3(5),7-dien-6-one.
| Compound Name | (1S,2R,11S,12S,14R,15R,16S)-15-hydroxy-15-(2-hydroxyacetyl)-2,14,16-trimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-3(5),7-dien-6-one |
|---|---|
| PubChem CID | 18719675 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | (1S,2R,11S,12S,14R,15R,16S)-15-hydroxy-15-(2-hydroxyacetyl)-2,14,16-trimethyl-4-oxapentacyclo[9.7.0.02,8.03,5.012,16]octadeca-3(5),7-dien-6-one |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C5=C(O5)[C@]4(C)[C@H]3CC[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H28O5/c1-11-8-15-13-5-4-12-9-16(24)18-19(27-18)21(12,3)14(13)6-7-20(15,2)22(11,26)17(25)10-23/h9,11,13-15,23,26H,4-8,10H2,1-3H3/t11-,13-,14+,15+,20+,21+,22+/m1/s1 |
| InChIKey | XPOOKWITUXHOGN-NBNARJLBSA-N |
| XLogP | 2.52 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |