C24H33N2O5P — CID 58600640
2-hydroxy-1-[(1S,2R,13S,14S,16R,20S,21S,23S)-23-hydroxy-2,7,21-trimethyl-18-phosphanyl-17,19-dioxa-6,7-diazahexacyclo[11.10.0.02,10.04,8.014,21.016,20]tricosa-4(8),5,9-trien-20-yl]ethanone (PubChem CID 58600640) has the molecular formula C24H33N2O5P and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-hydroxy-1-[(1S,2R,13S,14S,16R,20S,21S,23S)-23-hydroxy-2,7,21-trimethyl-18-phosphanyl-17,19-dioxa-6,7-diazahexacyclo[11.10.0.02,10.04,8.014,21.016,20]tricosa-4(8),5,9-trien-20-yl]ethanone.
| Compound Name | 2-hydroxy-1-[(1S,2R,13S,14S,16R,20S,21S,23S)-23-hydroxy-2,7,21-trimethyl-18-phosphanyl-17,19-dioxa-6,7-diazahexacyclo[11.10.0.02,10.04,8.014,21.016,20]tricosa-4(8),5,9-trien-20-yl]ethanone |
|---|---|
| PubChem CID | 58600640 |
| Molecular Formula | C24H33N2O5P |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 2-hydroxy-1-[(1S,2R,13S,14S,16R,20S,21S,23S)-23-hydroxy-2,7,21-trimethyl-18-phosphanyl-17,19-dioxa-6,7-diazahexacyclo[11.10.0.02,10.04,8.014,21.016,20]tricosa-4(8),5,9-trien-20-yl]ethanone |
| SMILES | Cn1ncc2c1C=C1CC[C@@H]3[C@H]([C@@H](O)C[C@@]4(C)[C@H]3C[C@H]3OC(P)O[C@]34C(=O)CO)[C@@]1(C)C2 |
| InChI | InChI=1S/C24H33N2O5P/c1-22-8-12-10-25-26(3)16(12)6-13(22)4-5-14-15-7-19-24(18(29)11-27,31-21(32)30-19)23(15,2)9-17(28)20(14)22/h6,10,14-15,17,19-21,27-28H,4-5,7-9,11,32H2,1-3H3/t14-,15-,17-,19+,20+,21?,22-,23-,24+/m0/s1 |
| InChIKey | ZNSAVKNXGPBLNQ-PCUIOCPYSA-N |
| XLogP | 2.06 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|