C25H38O5 — CID 91075422
ethane;2-hydroxy-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-15,17-dien-8-yl]ethanone (PubChem CID 91075422) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is ethane;2-hydroxy-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-15,17-dien-8-yl]ethanone.
| Compound Name | ethane;2-hydroxy-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-15,17-dien-8-yl]ethanone |
|---|---|
| PubChem CID | 91075422 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | ethane;2-hydroxy-1-[(1S,2S,4R,8S,9S,11S,12S,13R)-11-hydroxy-6,9,13-trimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-15,17-dien-8-yl]ethanone |
| SMILES | CC.CC1O[C@@H]2C[C@H]3[C@@H]4CCC5=CC=CC[C@]5(C)[C@H]4[C@@H](O)C[C@]3(C)[C@]2(C(=O)CO)O1 |
| InChI | InChI=1S/C23H32O5.C2H6/c1-13-27-19-10-16-15-8-7-14-6-4-5-9-21(14,2)20(15)17(25)11-22(16,3)23(19,28-13)18(26)12-24;1-2/h4-6,13,15-17,19-20,24-25H,7-12H2,1-3H3;1-2H3/t13?,15-,16-,17-,19+,20+,21-,22-,23+;/m0./s1 |
| InChIKey | SPUKJYAQGBCSDX-RTUPRYECSA-N |
| XLogP | 3.78 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |