C24H34O6 — CID 142968243
(2Z)-2-[(1S,7S)-8-hydroxy-11-(2-hydroxyacetyl)-6,10,13-trimethyl-6-[(Z)-prop-1-enyl]-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadecan-5-ylidene]acetaldehyde (PubChem CID 142968243) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is (2Z)-2-[(1S,7S)-8-hydroxy-11-(2-hydroxyacetyl)-6,10,13-trimethyl-6-[(Z)-prop-1-enyl]-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadecan-5-ylidene]acetaldehyde.
| Compound Name | (2Z)-2-[(1S,7S)-8-hydroxy-11-(2-hydroxyacetyl)-6,10,13-trimethyl-6-[(Z)-prop-1-enyl]-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadecan-5-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 142968243 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (2Z)-2-[(1S,7S)-8-hydroxy-11-(2-hydroxyacetyl)-6,10,13-trimethyl-6-[(Z)-prop-1-enyl]-12,14-dioxatetracyclo[8.6.0.02,7.011,15]hexadecan-5-ylidene]acetaldehyde |
| SMILES | C/C=C\C1(C)/C(=C\C=O)CCC2[C@@H]1C(O)CC1(C)[C@H]2CC2OC(C)OC21C(=O)CO |
| InChI | InChI=1S/C24H34O6/c1-5-9-22(3)15(8-10-25)6-7-16-17-11-20-24(19(28)13-26,30-14(2)29-20)23(17,4)12-18(27)21(16)22/h5,8-10,14,16-18,20-21,26-27H,6-7,11-13H2,1-4H3/b9-5-,15-8-/t14?,16?,17-,18?,20?,21+,22?,23?,24?/m0/s1 |
| InChIKey | FAQQRVQDYPQYLS-LUHVFEFZSA-N |
| XLogP | 2.57 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|