C22H36O2 — CID 143830084
(2Z)-2-[6-ethyl-8-hydroxy-1,6-dimethyl-1-[(Z)-prop-1-enyl]-5-propyl-4,4a,5,7,8,8a-hexahydro-3H-naphthalen-2-ylidene]acetaldehyde (PubChem CID 143830084) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is (2Z)-2-[6-ethyl-8-hydroxy-1,6-dimethyl-1-[(Z)-prop-1-enyl]-5-propyl-4,4a,5,7,8,8a-hexahydro-3H-naphthalen-2-ylidene]acetaldehyde.
| Compound Name | (2Z)-2-[6-ethyl-8-hydroxy-1,6-dimethyl-1-[(Z)-prop-1-enyl]-5-propyl-4,4a,5,7,8,8a-hexahydro-3H-naphthalen-2-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 143830084 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (2Z)-2-[6-ethyl-8-hydroxy-1,6-dimethyl-1-[(Z)-prop-1-enyl]-5-propyl-4,4a,5,7,8,8a-hexahydro-3H-naphthalen-2-ylidene]acetaldehyde |
| SMILES | C/C=C\C1(C)/C(=C\C=O)CCC2C(CCC)C(C)(CC)CC(O)C21 |
| InChI | InChI=1S/C22H36O2/c1-6-9-18-17-11-10-16(12-14-23)22(5,13-7-2)20(17)19(24)15-21(18,4)8-3/h7,12-14,17-20,24H,6,8-11,15H2,1-5H3/b13-7-,16-12- |
| InChIKey | DNMXYERHBVDMMA-XNGWWFECSA-N |
| XLogP | 5.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|