C20H32O — CID 142985288
3,3a,6-trimethyl-7-methylidene-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-5-ol (PubChem CID 142985288) has the molecular formula C20H32O and a molecular weight of 288.48 g/mol. Its IUPAC name is 3,3a,6-trimethyl-7-methylidene-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-5-ol.
| Compound Name | 3,3a,6-trimethyl-7-methylidene-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-5-ol |
|---|---|
| PubChem CID | 142985288 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 3,3a,6-trimethyl-7-methylidene-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-5-ol |
| SMILES | C=C1CCC2C(C(O)CC3(C)C(C)CCC23)C1(C)/C=C\C |
| InChI | InChI=1S/C20H32O/c1-6-11-19(4)13(2)7-9-15-16-10-8-14(3)20(16,5)12-17(21)18(15)19/h6,11,14-18,21H,2,7-10,12H2,1,3-5H3/b11-6- |
| InChIKey | LAAHJAQIRKZFRF-WDZFZDKYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|