C21H34O2 — CID 143829999
7-ethyl-5-hydroxy-4a,7-dimethyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 143829999) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 7-ethyl-5-hydroxy-4a,7-dimethyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | 7-ethyl-5-hydroxy-4a,7-dimethyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 143829999 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 7-ethyl-5-hydroxy-4a,7-dimethyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | CCCC1C2CCC3=CC(=O)CCC3(C)C2C(O)CC1(C)CC |
| InChI | InChI=1S/C21H34O2/c1-5-7-17-16-9-8-14-12-15(22)10-11-21(14,4)19(16)18(23)13-20(17,3)6-2/h12,16-19,23H,5-11,13H2,1-4H3 |
| InChIKey | VRFWYMGVBUEOOF-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |