C15H22O3 — CID 11900315
(4aR,4bS,5R,8S,8aS)-5,8-dihydroxy-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one (PubChem CID 11900315) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (4aR,4bS,5R,8S,8aS)-5,8-dihydroxy-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one.
| Compound Name | (4aR,4bS,5R,8S,8aS)-5,8-dihydroxy-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one |
|---|---|
| PubChem CID | 11900315 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (4aR,4bS,5R,8S,8aS)-5,8-dihydroxy-4a-methyl-3,4,4b,5,6,7,8,8a,9,10-decahydrophenanthren-2-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@H]1[C@@H]2[C@H](O)CC[C@@H]1O |
| InChI | InChI=1S/C15H22O3/c1-15-7-6-10(16)8-9(15)2-3-11-12(17)4-5-13(18)14(11)15/h8,11-14,17-18H,2-7H2,1H3/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | AOMIEBNQFOURPP-KHMAMNHCSA-N |
| XLogP | 1.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |