C22H34O2 — CID 143128947
4a,7-dimethyl-7-propanoyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one (PubChem CID 143128947) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 4a,7-dimethyl-7-propanoyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one.
| Compound Name | 4a,7-dimethyl-7-propanoyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
|---|---|
| PubChem CID | 143128947 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 4a,7-dimethyl-7-propanoyl-8-propyl-4,4b,5,6,8,8a,9,10-octahydro-3H-phenanthren-2-one |
| SMILES | CCCC1C2CCC3=CC(=O)CCC3(C)C2CCC1(C)C(=O)CC |
| InChI | InChI=1S/C22H34O2/c1-5-7-18-17-9-8-15-14-16(23)10-12-21(15,3)19(17)11-13-22(18,4)20(24)6-2/h14,17-19H,5-13H2,1-4H3 |
| InChIKey | RCEINHONOCZQIL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |