C22H34O — CID 143830362
(2Z)-2-[(2R)-2,3,3a,6-tetramethyl-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetaldehyde (PubChem CID 143830362) has the molecular formula C22H34O and a molecular weight of 314.51 g/mol. Its IUPAC name is (2Z)-2-[(2R)-2,3,3a,6-tetramethyl-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetaldehyde.
| Compound Name | (2Z)-2-[(2R)-2,3,3a,6-tetramethyl-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetaldehyde |
|---|---|
| PubChem CID | 143830362 |
| Molecular Formula | C22H34O |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (2Z)-2-[(2R)-2,3,3a,6-tetramethyl-6-[(Z)-prop-1-enyl]-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-7-ylidene]acetaldehyde |
| SMILES | C/C=C\C1(C)/C(=C\C=O)CCC2C1CCC1(C)C2C[C@@H](C)C1C |
| InChI | InChI=1S/C22H34O/c1-6-11-22(5)17(10-13-23)7-8-18-19(22)9-12-21(4)16(3)15(2)14-20(18)21/h6,10-11,13,15-16,18-20H,7-9,12,14H2,1-5H3/b11-6-,17-10-/t15-,16?,18?,19?,20?,21?,22?/m1/s1 |
| InChIKey | PGAURWHLLULTME-UICQHXOTSA-N |
| XLogP | 5.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|