C24H33N — CID 143172952
2-[(7Z)-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]prop-2-enenitrile (PubChem CID 143172952) has the molecular formula C24H33N and a molecular weight of 335.54 g/mol. Its IUPAC name is 2-[(7Z)-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]prop-2-enenitrile.
| Compound Name | 2-[(7Z)-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 143172952 |
| Molecular Formula | C24H33N |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | 2-[(7Z)-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]prop-2-enenitrile |
| SMILES | C=C/C=C1/CCC2C(CCC3(C)C(C(=C)C#N)CCC23)C1(C)/C=C\C |
| InChI | InChI=1S/C24H33N/c1-6-8-18-9-10-19-21-12-11-20(17(3)16-25)24(21,5)15-13-22(19)23(18,4)14-7-2/h6-8,14,19-22H,1,3,9-13,15H2,2,4-5H3/b14-7-,18-8- |
| InChIKey | DIQFWGXJSPQINE-SIZMJIRJSA-N |
| XLogP | 6.61 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|