C24H32FNO — CID 162688008
fluoromethane;2-[(6Z)-5-methyl-6-(2-oxoethylidene)-5-[(Z)-prop-1-enyl]-14-tetracyclo[8.5.0.01,13.04,9]pentadec-14-enyl]acetonitrile (PubChem CID 162688008) has the molecular formula C24H32FNO and a molecular weight of 369.52 g/mol. Its IUPAC name is fluoromethane;2-[(6Z)-5-methyl-6-(2-oxoethylidene)-5-[(Z)-prop-1-enyl]-14-tetracyclo[8.5.0.01,13.04,9]pentadec-14-enyl]acetonitrile.
| Compound Name | fluoromethane;2-[(6Z)-5-methyl-6-(2-oxoethylidene)-5-[(Z)-prop-1-enyl]-14-tetracyclo[8.5.0.01,13.04,9]pentadec-14-enyl]acetonitrile |
|---|---|
| PubChem CID | 162688008 |
| Molecular Formula | C24H32FNO |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | fluoromethane;2-[(6Z)-5-methyl-6-(2-oxoethylidene)-5-[(Z)-prop-1-enyl]-14-tetracyclo[8.5.0.01,13.04,9]pentadec-14-enyl]acetonitrile |
| SMILES | C/C=C\C1(C)/C(=C\C=O)CCC2C1CCC13C=C(CC#N)C1CCC23.CF |
| InChI | InChI=1S/C23H29NO.CH3F/c1-3-11-22(2)17(10-14-25)4-5-18-20(22)8-12-23-15-16(9-13-24)19(23)6-7-21(18)23;1-2/h3,10-11,14-15,18-21H,4-9,12H2,1-2H3;1H3/b11-3-,17-10-; |
| InChIKey | WJDVGIANOQCJEM-WEOOUJKBSA-N |
| XLogP | 5.97 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|