C32H54FN — CID 168883709
1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-(6-fluoro-6-methyloctyl)ethanimine (PubChem CID 168883709) has the molecular formula C32H54FN and a molecular weight of 471.79 g/mol. Its IUPAC name is 1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-(6-fluoro-6-methyloctyl)ethanimine.
| Compound Name | 1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-(6-fluoro-6-methyloctyl)ethanimine |
|---|---|
| PubChem CID | 168883709 |
| Molecular Formula | C32H54FN |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.42 |
| IUPAC Name | 1-[(7Z)-3a,6-dimethyl-7-prop-2-enylidene-6-propyl-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-3-yl]-N-(6-fluoro-6-methyloctyl)ethanimine |
| SMILES | C=C/C=C1/CCC2C(CCC3(C)C(/C(C)=N/CCCCCC(C)(F)CC)CCC23)C1(C)CCC |
| InChI | InChI=1S/C32H54FN/c1-8-14-25-15-16-26-28-18-17-27(24(4)34-23-13-11-12-21-30(5,33)10-3)32(28,7)22-19-29(26)31(25,6)20-9-2/h8,14,26-29H,1,9-13,15-23H2,2-7H3/b25-14-,34-24+ |
| InChIKey | BUNPJTNEHALTMS-QLQHWDILSA-N |
| XLogP | 9.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|