C29H36O6 — CID 167194100
(1S,2S,8S,9S,11S,12S,13R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 167194100) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is (1S,2S,8S,9S,11S,12S,13R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (1S,2S,8S,9S,11S,12S,13R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 167194100 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (1S,2S,8S,9S,11S,12S,13R)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-11-hydroxy-8-(2-hydroxyacetyl)-9,13-dimethyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | C=C/C(=C\C=C/C)C1OC2C[C@H]3[C@@H]4CCC5=CC(=O)C=C[C@]5(C)[C@H]4[C@@H](O)C[C@]3(C)[C@]2(C(=O)CO)O1 |
| InChI | InChI=1S/C29H36O6/c1-5-7-8-17(6-2)26-34-24-14-21-20-10-9-18-13-19(31)11-12-27(18,3)25(20)22(32)15-28(21,4)29(24,35-26)23(33)16-30/h5-8,11-13,20-22,24-26,30,32H,2,9-10,14-16H2,1,3-4H3/b7-5-,17-8+/t20-,21-,22-,24?,25+,26?,27-,28-,29+/m0/s1 |
| InChIKey | TVXOAVVLNJQXBW-NERQOTPMSA-N |
| XLogP | 3.61 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|