C27H30FN3O4 — CID 70843878
(2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,11,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carboxylic acid (PubChem CID 70843878) has the molecular formula C27H30FN3O4 and a molecular weight of 479.55 g/mol. Its IUPAC name is (2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,11,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carboxylic acid.
| Compound Name | (2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,11,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carboxylic acid |
|---|---|
| PubChem CID | 70843878 |
| Molecular Formula | C27H30FN3O4 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | (2R,13S,17R,18S,20S)-7-(6-fluoro-3-pyridinyl)-17,20-dihydroxy-2,11,18-trimethyl-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9,11-tetraene-17-carboxylic acid |
| SMILES | CC1=C[C@@H]2C(C(O)C[C@@]3(C)C2CC[C@]3(O)C(=O)O)[C@@]2(C)Cc3cnn(-c4ccc(F)nc4)c3C=C12 |
| InChI | InChI=1S/C27H30FN3O4/c1-14-8-17-18-6-7-27(35,24(33)34)26(18,3)11-21(32)23(17)25(2)10-15-12-30-31(20(15)9-19(14)25)16-4-5-22(28)29-13-16/h4-5,8-9,12-13,17-18,21,23,32,35H,6-7,10-11H2,1-3H3,(H,33,34)/t17-,18?,21?,23?,25-,26-,27-/m0/s1 |
| InChIKey | NOUSHEFGMGTMSE-VULNNDGDSA-N |
| XLogP | 3.54 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|