C26H36O8 — CID 14233393
CID 14233393 (PubChem CID 14233393) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol.
| Compound Name | CID 14233393 |
|---|---|
| PubChem CID | 14233393 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | — |
| SMILES | COC(=O)C[C@@H]1C[C@@H]2[C@H]([C@@H](O)C[C@@]3(C)[C@H]2CC[C@@]32OCOC23COCO3)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C26H36O8/c1-23-6-4-16(27)10-19(23)15(9-21(29)30-3)8-17-18-5-7-25(24(18,2)11-20(28)22(17)23)26(34-14-32-25)12-31-13-33-26/h10,15,17-18,20,22,28H,4-9,11-14H2,1-3H3/t15-,17-,18-,20-,22+,23-,24-,25+,26?/m0/s1 |
| InChIKey | LYKVCISBLYJHQT-HEUFRHTNSA-N |
| XLogP | 2.72 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |